Pyridine, 4-(4-fluorophenyl)-1,2,3,6-tetrahydro-, hydrochloride - Names and Identifiers
Name | 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride
|
Synonyms | 1,2,3,6-tetrahydro-4-(p-fluorophenyl)-pyridinhydrochloride 4-(4-FLUOROPHENYL)-1,2,3,6-TETRAHYDROPYRIDINE HYDROCHLORID 4-(4-Fluorophenyl)-1,2,5,6-tetrahydropyridine Hydrochloride 4-(4-FLUOROPHENYL)-1,2,3,6-TETRAHYDROPYRIDINE HYDROCHLORIDE 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride Pyridine, 4-(4-fluorophenyl)-1,2,3,6-tetrahydro-, hydrochloride 1-Fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzene hydrochloride
|
CAS | 1978-61-6
|
EINECS | 217-836-9 |
InChI | InChI=1/C11H12FN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2/p+1 |
Pyridine, 4-(4-fluorophenyl)-1,2,3,6-tetrahydro-, hydrochloride - Physico-chemical Properties
Molecular Formula | C11H13ClFN
|
Molar Mass | 213.68 |
Melting Point | 169-173 °C |
Boling Point | 264°C at 760 mmHg |
Flash Point | 113.4°C |
Solubility | DMSO (Slightly), Water (Slightly) |
Vapor Presure | 0.00997mmHg at 25°C |
Appearance | Solid |
Color | Light Brown to Brown |
Storage Condition | Hygroscopic, -20°C Freezer, Under inert atmosphere |
Stability | Hygroscopic |
Pyridine, 4-(4-fluorophenyl)-1,2,3,6-tetrahydro-, hydrochloride - Risk and Safety
Hazard Symbols | T - Toxic
|
Risk Codes | R40 - Limited evidence of a carcinogenic effect
R23/24/25 - Toxic by inhalation, in contact with skin and if swallowed.
|
Safety Description | S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.)
S38 - In case of insufficient ventilation, wear suitable respiratory equipment.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
S28A -
|
HS Code | 29333999 |
Pyridine, 4-(4-fluorophenyl)-1,2,3,6-tetrahydro-, hydrochloride - Introduction
4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride, also known as 4-(4-fluorophenyl)-piperidine hydrochloride or 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride, which has the following properties:
1. Appearance: white crystal or crystalline powder;
2. Molecular formula: C11H14FN · HCl;
3. Molecular weight: 225.69g/mol;
4. Melting Point: 166-168 C;
5. Solubility: Soluble in water and organic solvents.
4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride is mainly used as follows:
1. Drug synthesis: In the field of drug synthesis, it can be used as a synthetic intermediate to participate in the synthesis of various drugs;
2. Preparation of polymer materials: can be used to synthesize polymer materials, such as polymers, polymer nanocomposites, etc;
3. Chemical and scientific research: It is also a commonly used reagent in chemical and scientific research.
Its preparation method is generally as follows:
1. First, 4-fluorophenylboronic acid is reacted with 1,2,3,6-tetrahydropyridine to produce 4-(4-fluorophenyl)-1,2,3, 6-tetrahydropyridine;
2. Then, the obtained 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine is reacted with hydrochloric acid to produce 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride.
Regarding safety information, 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride is a chemical and has certain safety risks. Chemical practices and safety measures must be strictly followed, such as wearing personal protective equipment (e. G. Lab gloves, glasses, lab coats, etc.), maintaining good ventilation, and proper storage and handling of chemicals. Care should be taken to avoid contact with skin, eyes, and mucous membranes during use and handling. In case of contact, immediately flush the affected area with plenty of water and seek medical help.
Last Update:2024-04-09 21:01:54